C11H17N4O11P3S — CID 10164296
[[(2S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-methyl-1,3-oxathiolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 10164296) has the molecular formula C11H17N4O11P3S and a molecular weight of 506.26 g/mol. Its IUPAC name is [[(2S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-methyl-1,3-oxathiolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-methyl-1,3-oxathiolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 10164296 |
| Molecular Formula | C11H17N4O11P3S |
| Molecular Weight | 506.26 g/mol |
| Exact Mass | 505.98 |
| IUPAC Name | [[(2S,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-methyl-1,3-oxathiolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@H]1S[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C11H17N4O11P3S/c1-6-11(15-3-2-7-9(12)13-5-14-10(7)15)24-8(30-6)4-23-28(19,20)26-29(21,22)25-27(16,17)18/h2-3,5-6,8,11H,4H2,1H3,(H,19,20)(H,21,22)(H2,12,13,14)(H2,16,17,18)/t6-,8+,11-/m1/s1 |
| InChIKey | AHWODWGKWIKIJO-CDOJRTKCSA-N |
| XLogP | 1.33 |
| TPSA | 225.78 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 30 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.26 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|