C10H18N5O19P5 — CID 174305704
[[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-diphosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 174305704) has the molecular formula C10H18N5O19P5 and a molecular weight of 667.14 g/mol. Its IUPAC name is [[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-diphosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-diphosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 174305704 |
| Molecular Formula | C10H18N5O19P5 |
| Molecular Weight | 667.14 g/mol |
| Exact Mass | 666.93 |
| IUPAC Name | [[(2R,4S,5R)-5-(6-aminopurin-9-yl)-3,4-diphosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | Nc1ncnc2c1ncn2[C@@H]1O[C@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)C(OP(=O)(O)O)[C@@H]1OP(=O)(O)O |
| InChI | InChI=1S/C10H18N5O19P5/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(32-36(19,20)21)6(31-35(16,17)18)4(30-10)1-29-38(25,26)34-39(27,28)33-37(22,23)24/h2-4,6-7,10H,1H2,(H,25,26)(H,27,28)(H2,11,12,13)(H2,16,17,18)(H2,19,20,21)(H2,22,23,24)/t4-,6?,7+,10-/m1/s1 |
| InChIKey | BXTMJIXKAITKGD-HMEJCUHCSA-N |
| XLogP | -1.39 |
| TPSA | 372.19 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 16 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 667.14 |
| LogP ≤ 5 | -1.39 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 16 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|