C14H21N4O13P3 — CID 138702569
[[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-prop-1-en-2-yloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 138702569) has the molecular formula C14H21N4O13P3 and a molecular weight of 546.26 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-prop-1-en-2-yloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-prop-1-en-2-yloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 138702569 |
| Molecular Formula | C14H21N4O13P3 |
| Molecular Weight | 546.26 g/mol |
| Exact Mass | 546.03 |
| IUPAC Name | [[(2R,3R,4R,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-prop-1-en-2-yloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C=C(C)[C@@]1(O)[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1ccc2c(N)ncnc21 |
| InChI | InChI=1S/C14H21N4O13P3/c1-7(2)14(20)10(19)9(5-28-33(24,25)31-34(26,27)30-32(21,22)23)29-13(14)18-4-3-8-11(15)16-6-17-12(8)18/h3-4,6,9-10,13,19-20H,1,5H2,2H3,(H,24,25)(H,26,27)(H2,15,16,17)(H2,21,22,23)/t9-,10-,13-,14-/m1/s1 |
| InChIKey | CPMUVNPNGRZMMR-DMTCVQMQSA-N |
| XLogP | -0.08 |
| TPSA | 266.24 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 13 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.26 |
| LogP ≤ 5 | -0.08 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 13 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|