C12H21N6O13P3 — CID 91063794
[[(2R,3R,4R,5R)-5-(4-amino-5-hydrazinylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate (PubChem CID 91063794) has the molecular formula C12H21N6O13P3 and a molecular weight of 550.25 g/mol. Its IUPAC name is [[(2R,3R,4R,5R)-5-(4-amino-5-hydrazinylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate.
| Compound Name | [[(2R,3R,4R,5R)-5-(4-amino-5-hydrazinylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 91063794 |
| Molecular Formula | C12H21N6O13P3 |
| Molecular Weight | 550.25 g/mol |
| Exact Mass | 550.04 |
| IUPAC Name | [[(2R,3R,4R,5R)-5-(4-amino-5-hydrazinylpyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methoxy-hydroxyphosphoryl] phosphono hydrogen phosphate |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](COP(=O)(O)OP(=O)(O)OP(=O)(O)O)O[C@H]1n1cc(NN)c2c(N)ncnc21 |
| InChI | InChI=1S/C12H21N6O13P3/c1-12(20)8(19)6(3-28-33(24,25)31-34(26,27)30-32(21,22)23)29-11(12)18-2-5(17-14)7-9(13)15-4-16-10(7)18/h2,4,6,8,11,17,19-20H,3,14H2,1H3,(H,24,25)(H,26,27)(H2,13,15,16)(H2,21,22,23)/t6-,8-,11-,12-/m1/s1 |
| InChIKey | RCXOUURFMKOHDU-YUTYNTIBSA-N |
| XLogP | -1.35 |
| TPSA | 304.29 Ų |
| H-Bond Donors | 9 |
| H-Bond Acceptors | 15 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.25 |
| LogP ≤ 5 | -1.35 |
| H-Bond Donors ≤ 5 | 9 |
| H-Bond Acceptors ≤ 10 | 15 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|