C12H16N5O9P — CID 69196961
[(2R,3R,4R,5R)-5-(4-amino-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl dihydrogen phosphate (PubChem CID 69196961) has the molecular formula C12H16N5O9P and a molecular weight of 405.26 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-(4-amino-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl dihydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-(4-amino-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl dihydrogen phosphate |
|---|---|
| PubChem CID | 69196961 |
| Molecular Formula | C12H16N5O9P |
| Molecular Weight | 405.26 g/mol |
| Exact Mass | 405.07 |
| IUPAC Name | [(2R,3R,4R,5R)-5-(4-amino-5-nitropyrrolo[2,3-d]pyrimidin-7-yl)-3,4-dihydroxy-4-methyloxolan-2-yl]methyl dihydrogen phosphate |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](COP(=O)(O)O)O[C@H]1n1cc([N+](=O)[O-])c2c(N)ncnc21 |
| InChI | InChI=1S/C12H16N5O9P/c1-12(19)8(18)6(3-25-27(22,23)24)26-11(12)16-2-5(17(20)21)7-9(13)14-4-15-10(7)16/h2,4,6,8,11,18-19H,3H2,1H3,(H2,13,14,15)(H2,22,23,24)/t6-,8-,11-,12-/m1/s1 |
| InChIKey | SSAXUBXHRNIHLK-YUTYNTIBSA-N |
| XLogP | -0.96 |
| TPSA | 216.32 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.26 |
| LogP ≤ 5 | -0.96 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|