C15H22N4O11P2 — CID 87846970
[(2R,3R,4R,5R)-5-[4-amino-5-(2-methoxyethenyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methyl phosphono hydrogen phosphate (PubChem CID 87846970) has the molecular formula C15H22N4O11P2 and a molecular weight of 496.31 g/mol. Its IUPAC name is [(2R,3R,4R,5R)-5-[4-amino-5-(2-methoxyethenyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methyl phosphono hydrogen phosphate.
| Compound Name | [(2R,3R,4R,5R)-5-[4-amino-5-(2-methoxyethenyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methyl phosphono hydrogen phosphate |
|---|---|
| PubChem CID | 87846970 |
| Molecular Formula | C15H22N4O11P2 |
| Molecular Weight | 496.31 g/mol |
| Exact Mass | 496.08 |
| IUPAC Name | [(2R,3R,4R,5R)-5-[4-amino-5-(2-methoxyethenyl)pyrrolo[2,3-d]pyrimidin-7-yl]-3,4-dihydroxy-4-methyloxolan-2-yl]methyl phosphono hydrogen phosphate |
| SMILES | COC=Cc1cn([C@@H]2O[C@H](COP(=O)(O)OP(=O)(O)O)[C@@H](O)[C@@]2(C)O)c2ncnc(N)c12 |
| InChI | InChI=1S/C15H22N4O11P2/c1-15(21)11(20)9(6-28-32(25,26)30-31(22,23)24)29-14(15)19-5-8(3-4-27-2)10-12(16)17-7-18-13(10)19/h3-5,7,9,11,14,20-21H,6H2,1-2H3,(H,25,26)(H2,16,17,18)(H2,22,23,24)/t9-,11-,14-,15-/m1/s1 |
| InChIKey | PUZFYCYUPAEOSI-NZQZLILVSA-N |
| XLogP | -0.13 |
| TPSA | 228.94 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.31 |
| LogP ≤ 5 | -0.13 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|