C15H20N4O6 — CID 21040822
2-[4-(hydroxyamino)-5-[(E)-2-methoxyethenyl]pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol (PubChem CID 21040822) has the molecular formula C15H20N4O6 and a molecular weight of 352.35 g/mol. Its IUPAC name is 2-[4-(hydroxyamino)-5-[(E)-2-methoxyethenyl]pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol.
| Compound Name | 2-[4-(hydroxyamino)-5-[(E)-2-methoxyethenyl]pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 21040822 |
| Molecular Formula | C15H20N4O6 |
| Molecular Weight | 352.35 g/mol |
| Exact Mass | 352.14 |
| IUPAC Name | 2-[4-(hydroxyamino)-5-[(E)-2-methoxyethenyl]pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
| SMILES | CO/C=C/c1cn(C2OC(CO)C(O)C2(C)O)c2ncnc(NO)c12 |
| InChI | InChI=1S/C15H20N4O6/c1-15(22)11(21)9(6-20)25-14(15)19-5-8(3-4-24-2)10-12(18-23)16-7-17-13(10)19/h3-5,7,9,11,14,20-23H,6H2,1-2H3,(H,16,17,18)/b4-3+ |
| InChIKey | FQLUZHGRTUGYFO-ONEGZZNKSA-N |
| XLogP | -0.15 |
| TPSA | 142.12 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.35 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|