C13H16ClN5O5 — CID 11952596
(2R,3R,4R,5R)-4-chloro-5-[4-(hydroxyamino)-5-[(E)-hydroxyiminomethyl]pyrrolo[2,3-d]pyrimidin-7-yl]-2-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 11952596) has the molecular formula C13H16ClN5O5 and a molecular weight of 357.75 g/mol. Its IUPAC name is (2R,3R,4R,5R)-4-chloro-5-[4-(hydroxyamino)-5-[(E)-hydroxyiminomethyl]pyrrolo[2,3-d]pyrimidin-7-yl]-2-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-4-chloro-5-[4-(hydroxyamino)-5-[(E)-hydroxyiminomethyl]pyrrolo[2,3-d]pyrimidin-7-yl]-2-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 11952596 |
| Molecular Formula | C13H16ClN5O5 |
| Molecular Weight | 357.75 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | (2R,3R,4R,5R)-4-chloro-5-[4-(hydroxyamino)-5-[(E)-hydroxyiminomethyl]pyrrolo[2,3-d]pyrimidin-7-yl]-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | C[C@@]1(Cl)[C@H](O)[C@@H](CO)O[C@H]1n1cc(/C=N/O)c2c(NO)ncnc21 |
| InChI | InChI=1S/C13H16ClN5O5/c1-13(14)9(21)7(4-20)24-12(13)19-3-6(2-17-22)8-10(18-23)15-5-16-11(8)19/h2-3,5,7,9,12,20-23H,4H2,1H3,(H,15,16,18)/b17-2+/t7-,9-,12-,13-/m1/s1 |
| InChIKey | YOMGFJURDHWKJQ-NZVPARHASA-N |
| XLogP | 0.29 |
| TPSA | 145.25 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.75 |
| LogP ≤ 5 | 0.29 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|