C15H21ClN6O4 — CID 58732381
(4R,5R)-4-chloro-5-[4-(ethoxyamino)-5-[(E)-hydrazinylidenemethyl]pyrrolo[2,3-d]pyrimidin-7-yl]-2-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 58732381) has the molecular formula C15H21ClN6O4 and a molecular weight of 384.82 g/mol. Its IUPAC name is (4R,5R)-4-chloro-5-[4-(ethoxyamino)-5-[(E)-hydrazinylidenemethyl]pyrrolo[2,3-d]pyrimidin-7-yl]-2-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | (4R,5R)-4-chloro-5-[4-(ethoxyamino)-5-[(E)-hydrazinylidenemethyl]pyrrolo[2,3-d]pyrimidin-7-yl]-2-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 58732381 |
| Molecular Formula | C15H21ClN6O4 |
| Molecular Weight | 384.82 g/mol |
| Exact Mass | 384.13 |
| IUPAC Name | (4R,5R)-4-chloro-5-[4-(ethoxyamino)-5-[(E)-hydrazinylidenemethyl]pyrrolo[2,3-d]pyrimidin-7-yl]-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | CCONc1ncnc2c1c(/C=N/N)cn2[C@@H]1OC(CO)C(O)[C@@]1(C)Cl |
| InChI | InChI=1S/C15H21ClN6O4/c1-3-25-21-12-10-8(4-20-17)5-22(13(10)19-7-18-12)14-15(2,16)11(24)9(6-23)26-14/h4-5,7,9,11,14,23-24H,3,6,17H2,1-2H3,(H,18,19,21)/b20-4+/t9?,11?,14-,15-/m1/s1 |
| InChIKey | TULYRDAHCIVFLB-XMXVIOHXSA-N |
| XLogP | 0.34 |
| TPSA | 140.04 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.82 |
| LogP ≤ 5 | 0.34 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|