C19H28N4O5 — CID 143320779
ethane;5-[4-(ethoxyamino)-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl]-2-(hydroxymethyl)-4-methoxy-4-methyloxolan-3-ol (PubChem CID 143320779) has the molecular formula C19H28N4O5 and a molecular weight of 392.46 g/mol. Its IUPAC name is ethane;5-[4-(ethoxyamino)-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl]-2-(hydroxymethyl)-4-methoxy-4-methyloxolan-3-ol.
| Compound Name | ethane;5-[4-(ethoxyamino)-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl]-2-(hydroxymethyl)-4-methoxy-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 143320779 |
| Molecular Formula | C19H28N4O5 |
| Molecular Weight | 392.46 g/mol |
| Exact Mass | 392.21 |
| IUPAC Name | ethane;5-[4-(ethoxyamino)-5-ethynylpyrrolo[2,3-d]pyrimidin-7-yl]-2-(hydroxymethyl)-4-methoxy-4-methyloxolan-3-ol |
| SMILES | C#Cc1cn(C2OC(CO)C(O)C2(C)OC)c2ncnc(NOCC)c12.CC |
| InChI | InChI=1S/C17H22N4O5.C2H6/c1-5-10-7-21(15-12(10)14(18-9-19-15)20-25-6-2)16-17(3,24-4)13(23)11(8-22)26-16;1-2/h1,7,9,11,13,16,22-23H,6,8H2,2-4H3,(H,18,19,20);1-2H3 |
| InChIKey | WOLLFXDCLDZXSJ-UHFFFAOYSA-N |
| XLogP | 1.46 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.46 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|