C15H22N4O5 — CID 89263098
(4R,5R)-5-[4-(ethoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-2-(hydroxymethyl)-4-methoxy-4-methyloxolan-3-ol (PubChem CID 89263098) has the molecular formula C15H22N4O5 and a molecular weight of 338.36 g/mol. Its IUPAC name is (4R,5R)-5-[4-(ethoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-2-(hydroxymethyl)-4-methoxy-4-methyloxolan-3-ol.
| Compound Name | (4R,5R)-5-[4-(ethoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-2-(hydroxymethyl)-4-methoxy-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 89263098 |
| Molecular Formula | C15H22N4O5 |
| Molecular Weight | 338.36 g/mol |
| Exact Mass | 338.16 |
| IUPAC Name | (4R,5R)-5-[4-(ethoxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-2-(hydroxymethyl)-4-methoxy-4-methyloxolan-3-ol |
| SMILES | CCONc1ncnc2c1ccn2[C@@H]1OC(CO)C(O)[C@@]1(C)OC |
| InChI | InChI=1S/C15H22N4O5/c1-4-23-18-12-9-5-6-19(13(9)17-8-16-12)14-15(2,22-3)11(21)10(7-20)24-14/h5-6,8,10-11,14,20-21H,4,7H2,1-3H3,(H,16,17,18)/t10?,11?,14-,15-/m1/s1 |
| InChIKey | AXCMMAOXGCUFTB-FWFPMQDGSA-N |
| XLogP | 0.45 |
| TPSA | 110.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.36 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|