C12H16N4O5 — CID 59795692
(2R,3R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,5-bis(hydroxymethyl)oxolane-3,4-diol (PubChem CID 59795692) has the molecular formula C12H16N4O5 and a molecular weight of 296.28 g/mol. Its IUPAC name is (2R,3R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,5-bis(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,5-bis(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 59795692 |
| Molecular Formula | C12H16N4O5 |
| Molecular Weight | 296.28 g/mol |
| Exact Mass | 296.11 |
| IUPAC Name | (2R,3R,5R)-2-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-3,5-bis(hydroxymethyl)oxolane-3,4-diol |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1O[C@H](CO)C(O)[C@]1(O)CO |
| InChI | InChI=1S/C12H16N4O5/c13-9-6-1-2-16(10(6)15-5-14-9)11-12(20,4-18)8(19)7(3-17)21-11/h1-2,5,7-8,11,17-20H,3-4H2,(H2,13,14,15)/t7-,8?,11-,12-/m1/s1 |
| InChIKey | KGJUMKNRILMXFE-GXYJHATRSA-N |
| XLogP | -2.01 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.28 |
| LogP ≤ 5 | -2.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |