C11H12ClFN4O3 — CID 126550319
(2R,4S,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-chloro-4-fluoro-2-(hydroxymethyl)oxolan-3-ol (PubChem CID 126550319) has the molecular formula C11H12ClFN4O3 and a molecular weight of 302.69 g/mol. Its IUPAC name is (2R,4S,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-chloro-4-fluoro-2-(hydroxymethyl)oxolan-3-ol.
| Compound Name | (2R,4S,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-chloro-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
|---|---|
| PubChem CID | 126550319 |
| Molecular Formula | C11H12ClFN4O3 |
| Molecular Weight | 302.69 g/mol |
| Exact Mass | 302.06 |
| IUPAC Name | (2R,4S,5R)-5-(4-aminopyrrolo[2,3-d]pyrimidin-7-yl)-4-chloro-4-fluoro-2-(hydroxymethyl)oxolan-3-ol |
| SMILES | Nc1ncnc2c1ccn2[C@@H]1O[C@H](CO)C(O)[C@]1(F)Cl |
| InChI | InChI=1S/C11H12ClFN4O3/c12-11(13)7(19)6(3-18)20-10(11)17-2-1-5-8(14)15-4-16-9(5)17/h1-2,4,6-7,10,18-19H,3H2,(H2,14,15,16)/t6-,7?,10-,11-/m1/s1 |
| InChIKey | SEGDRPNNVFYNEC-ZMCKKRFWSA-N |
| XLogP | 0.17 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.69 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|