C20H23FN4O4 — CID 89263070
(4R,5R)-5-[4-(ethoxyamino)-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 89263070) has the molecular formula C20H23FN4O4 and a molecular weight of 402.43 g/mol. Its IUPAC name is (4R,5R)-5-[4-(ethoxyamino)-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | (4R,5R)-5-[4-(ethoxyamino)-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 89263070 |
| Molecular Formula | C20H23FN4O4 |
| Molecular Weight | 402.43 g/mol |
| Exact Mass | 402.17 |
| IUPAC Name | (4R,5R)-5-[4-(ethoxyamino)-5-phenylpyrrolo[2,3-d]pyrimidin-7-yl]-4-fluoro-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | CCONc1ncnc2c1c(-c1ccccc1)cn2[C@@H]1OC(CO)C(O)[C@@]1(C)F |
| InChI | InChI=1S/C20H23FN4O4/c1-3-28-24-17-15-13(12-7-5-4-6-8-12)9-25(18(15)23-11-22-17)19-20(2,21)16(27)14(10-26)29-19/h4-9,11,14,16,19,26-27H,3,10H2,1-2H3,(H,22,23,24)/t14?,16?,19-,20-/m1/s1 |
| InChIKey | HHRILXAHEGDWNK-VAZMBZEVSA-N |
| XLogP | 2.44 |
| TPSA | 101.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.43 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|