C16H19FN4O4 — CID 11953169
N-[5-ethenyl-7-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]acetamide (PubChem CID 11953169) has the molecular formula C16H19FN4O4 and a molecular weight of 350.35 g/mol. Its IUPAC name is N-[5-ethenyl-7-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]acetamide.
| Compound Name | N-[5-ethenyl-7-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 11953169 |
| Molecular Formula | C16H19FN4O4 |
| Molecular Weight | 350.35 g/mol |
| Exact Mass | 350.14 |
| IUPAC Name | N-[5-ethenyl-7-[(2R,3R,4R,5R)-3-fluoro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-4-yl]acetamide |
| SMILES | C=Cc1cn([C@@H]2O[C@H](CO)[C@@H](O)[C@@]2(C)F)c2ncnc(NC(C)=O)c12 |
| InChI | InChI=1S/C16H19FN4O4/c1-4-9-5-21(15-16(3,17)12(24)10(6-22)25-15)14-11(9)13(18-7-19-14)20-8(2)23/h4-5,7,10,12,15,22,24H,1,6H2,2-3H3,(H,18,19,20,23)/t10-,12-,15-,16-/m1/s1 |
| InChIKey | CCBRJAOTVUVLNZ-QTDMDRALSA-N |
| XLogP | 1.01 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.35 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |