C19H25ClN4O4Si — CID 58732340
N-[7-[(2R,3R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-5-(2-trimethylsilylethynyl)pyrrolo[2,3-d]pyrimidin-4-yl]acetamide (PubChem CID 58732340) has the molecular formula C19H25ClN4O4Si and a molecular weight of 436.97 g/mol. Its IUPAC name is N-[7-[(2R,3R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-5-(2-trimethylsilylethynyl)pyrrolo[2,3-d]pyrimidin-4-yl]acetamide.
| Compound Name | N-[7-[(2R,3R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-5-(2-trimethylsilylethynyl)pyrrolo[2,3-d]pyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 58732340 |
| Molecular Formula | C19H25ClN4O4Si |
| Molecular Weight | 436.97 g/mol |
| Exact Mass | 436.13 |
| IUPAC Name | N-[7-[(2R,3R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-5-(2-trimethylsilylethynyl)pyrrolo[2,3-d]pyrimidin-4-yl]acetamide |
| SMILES | CC(=O)Nc1ncnc2c1c(C#C[Si](C)(C)C)cn2[C@@H]1OC(CO)C(O)[C@@]1(C)Cl |
| InChI | InChI=1S/C19H25ClN4O4Si/c1-11(26)23-16-14-12(6-7-29(3,4)5)8-24(17(14)22-10-21-16)18-19(2,20)15(27)13(9-25)28-18/h8,10,13,15,18,25,27H,9H2,1-5H3,(H,21,22,23,26)/t13?,15?,18-,19-/m1/s1 |
| InChIKey | MNHQWYRRVUYLAF-NHADURIESA-N |
| XLogP | 1.87 |
| TPSA | 109.50 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.97 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|