C15H19ClN6O4 — CID 91091382
N-[7-[(2R,3R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-5-(diazenylmethyl)pyrrolo[2,3-d]pyrimidin-4-yl]acetamide (PubChem CID 91091382) has the molecular formula C15H19ClN6O4 and a molecular weight of 382.81 g/mol. Its IUPAC name is N-[7-[(2R,3R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-5-(diazenylmethyl)pyrrolo[2,3-d]pyrimidin-4-yl]acetamide.
| Compound Name | N-[7-[(2R,3R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-5-(diazenylmethyl)pyrrolo[2,3-d]pyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 91091382 |
| Molecular Formula | C15H19ClN6O4 |
| Molecular Weight | 382.81 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | N-[7-[(2R,3R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-5-(diazenylmethyl)pyrrolo[2,3-d]pyrimidin-4-yl]acetamide |
| SMILES | [H]/N=N/Cc1cn([C@@H]2OC(CO)C(O)[C@@]2(C)Cl)c2ncnc(NC(C)=O)c12 |
| InChI | InChI=1S/C15H19ClN6O4/c1-7(24)21-12-10-8(3-20-17)4-22(13(10)19-6-18-12)14-15(2,16)11(25)9(5-23)26-14/h4,6,9,11,14,17,23,25H,3,5H2,1-2H3,(H,18,19,21,24)/b20-17+/t9?,11?,14-,15-/m1/s1 |
| InChIKey | RZVSGTDLWSUDEY-OLCOVZOJSA-N |
| XLogP | 1.17 |
| TPSA | 145.71 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.81 |
| LogP ≤ 5 | 1.17 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'} |
|---|