C12H16BClN4O5 — CID 58732373
[4-amino-7-[(2R,3R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]boronic acid (PubChem CID 58732373) has the molecular formula C12H16BClN4O5 and a molecular weight of 342.55 g/mol. Its IUPAC name is [4-amino-7-[(2R,3R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]boronic acid.
| Compound Name | [4-amino-7-[(2R,3R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]boronic acid |
|---|---|
| PubChem CID | 58732373 |
| Molecular Formula | C12H16BClN4O5 |
| Molecular Weight | 342.55 g/mol |
| Exact Mass | 342.09 |
| IUPAC Name | [4-amino-7-[(2R,3R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]boronic acid |
| SMILES | C[C@@]1(Cl)C(O)C(CO)O[C@H]1n1cc(B(O)O)c2c(N)ncnc21 |
| InChI | InChI=1S/C12H16BClN4O5/c1-12(14)8(20)6(3-19)23-11(12)18-2-5(13(21)22)7-9(15)16-4-17-10(7)18/h2,4,6,8,11,19-22H,3H2,1H3,(H2,15,16,17)/t6?,8?,11-,12-/m1/s1 |
| InChIKey | ZGPWLBVLTPFCFH-HIWVQXRTSA-N |
| XLogP | -2.06 |
| TPSA | 146.88 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.55 |
| LogP ≤ 5 | -2.06 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|