C15H17ClN4O5 — CID 11952599
N-[7-[(2R,3R,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-5-formylpyrrolo[2,3-d]pyrimidin-4-yl]acetamide (PubChem CID 11952599) has the molecular formula C15H17ClN4O5 and a molecular weight of 368.78 g/mol. Its IUPAC name is N-[7-[(2R,3R,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-5-formylpyrrolo[2,3-d]pyrimidin-4-yl]acetamide.
| Compound Name | N-[7-[(2R,3R,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-5-formylpyrrolo[2,3-d]pyrimidin-4-yl]acetamide |
|---|---|
| PubChem CID | 11952599 |
| Molecular Formula | C15H17ClN4O5 |
| Molecular Weight | 368.78 g/mol |
| Exact Mass | 368.09 |
| IUPAC Name | N-[7-[(2R,3R,4R,5R)-3-chloro-4-hydroxy-5-(hydroxymethyl)-3-methyloxolan-2-yl]-5-formylpyrrolo[2,3-d]pyrimidin-4-yl]acetamide |
| SMILES | CC(=O)Nc1ncnc2c1c(C=O)cn2[C@@H]1O[C@H](CO)[C@@H](O)[C@@]1(C)Cl |
| InChI | InChI=1S/C15H17ClN4O5/c1-7(23)19-12-10-8(4-21)3-20(13(10)18-6-17-12)14-15(2,16)11(24)9(5-22)25-14/h3-4,6,9,11,14,22,24H,5H2,1-2H3,(H,17,18,19,23)/t9-,11-,14-,15-/m1/s1 |
| InChIKey | OZYXOBQDEJOQJN-NZQZLILVSA-N |
| XLogP | 0.45 |
| TPSA | 126.57 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.78 |
| LogP ≤ 5 | 0.45 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|