C17H23BrN4O3Si — CID 11952752
(2R,3R,4R,5R)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-4-bromo-2-(hydroxymethyl)-4-methyloxolan-3-ol (PubChem CID 11952752) has the molecular formula C17H23BrN4O3Si and a molecular weight of 439.39 g/mol. Its IUPAC name is (2R,3R,4R,5R)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-4-bromo-2-(hydroxymethyl)-4-methyloxolan-3-ol.
| Compound Name | (2R,3R,4R,5R)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-4-bromo-2-(hydroxymethyl)-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 11952752 |
| Molecular Formula | C17H23BrN4O3Si |
| Molecular Weight | 439.39 g/mol |
| Exact Mass | 438.07 |
| IUPAC Name | (2R,3R,4R,5R)-5-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-4-bromo-2-(hydroxymethyl)-4-methyloxolan-3-ol |
| SMILES | C[C@@]1(Br)[C@H](O)[C@@H](CO)O[C@H]1n1cc(C#C[Si](C)(C)C)c2c(N)ncnc21 |
| InChI | InChI=1S/C17H23BrN4O3Si/c1-17(18)13(24)11(8-23)25-16(17)22-7-10(5-6-26(2,3)4)12-14(19)20-9-21-15(12)22/h7,9,11,13,16,23-24H,8H2,1-4H3,(H2,19,20,21)/t11-,13-,16-,17-/m1/s1 |
| InChIKey | STJJMIQSRMSYLU-MCPWVCTESA-N |
| XLogP | 1.65 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 439.39 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|