C17H24N4O5Si — CID 11646837
(2R,3R,4R,5R)-2-[4-(hydroxyamino)-5-(2-trimethylsilylethynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol (PubChem CID 11646837) has the molecular formula C17H24N4O5Si and a molecular weight of 392.49 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-[4-(hydroxyamino)-5-(2-trimethylsilylethynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-[4-(hydroxyamino)-5-(2-trimethylsilylethynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 11646837 |
| Molecular Formula | C17H24N4O5Si |
| Molecular Weight | 392.49 g/mol |
| Exact Mass | 392.15 |
| IUPAC Name | (2R,3R,4R,5R)-2-[4-(hydroxyamino)-5-(2-trimethylsilylethynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](CO)O[C@H]1n1cc(C#C[Si](C)(C)C)c2c(NO)ncnc21 |
| InChI | InChI=1S/C17H24N4O5Si/c1-17(24)13(23)11(8-22)26-16(17)21-7-10(5-6-27(2,3)4)12-14(20-25)18-9-19-15(12)21/h7,9,11,13,16,22-25H,8H2,1-4H3,(H,18,19,20)/t11-,13-,16-,17-/m1/s1 |
| InChIKey | DEHMHWWPQWPKNW-MCPWVCTESA-N |
| XLogP | 0.46 |
| TPSA | 132.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 392.49 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|