C20H19FN4O5 — CID 11553411
(2R,3R,4R,5R)-2-[5-[2-(4-fluorophenyl)ethynyl]-4-(hydroxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol (PubChem CID 11553411) has the molecular formula C20H19FN4O5 and a molecular weight of 414.39 g/mol. Its IUPAC name is (2R,3R,4R,5R)-2-[5-[2-(4-fluorophenyl)ethynyl]-4-(hydroxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol.
| Compound Name | (2R,3R,4R,5R)-2-[5-[2-(4-fluorophenyl)ethynyl]-4-(hydroxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
|---|---|
| PubChem CID | 11553411 |
| Molecular Formula | C20H19FN4O5 |
| Molecular Weight | 414.39 g/mol |
| Exact Mass | 414.13 |
| IUPAC Name | (2R,3R,4R,5R)-2-[5-[2-(4-fluorophenyl)ethynyl]-4-(hydroxyamino)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)-3-methyloxolane-3,4-diol |
| SMILES | C[C@@]1(O)[C@H](O)[C@@H](CO)O[C@H]1n1cc(C#Cc2ccc(F)cc2)c2c(NO)ncnc21 |
| InChI | InChI=1S/C20H19FN4O5/c1-20(28)16(27)14(9-26)30-19(20)25-8-12(5-2-11-3-6-13(21)7-4-11)15-17(24-29)22-10-23-18(15)25/h3-4,6-8,10,14,16,19,26-29H,9H2,1H3,(H,22,23,24)/t14-,16-,19-,20-/m1/s1 |
| InChIKey | LYOKRWBDIVAZAD-BGRCLHOASA-N |
| XLogP | 0.77 |
| TPSA | 132.89 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.39 |
| LogP ≤ 5 | 0.77 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|