C16H22N4O4Si — CID 123180664
(2R,3S,5R)-2-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol (PubChem CID 123180664) has the molecular formula C16H22N4O4Si and a molecular weight of 362.46 g/mol. Its IUPAC name is (2R,3S,5R)-2-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol.
| Compound Name | (2R,3S,5R)-2-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
|---|---|
| PubChem CID | 123180664 |
| Molecular Formula | C16H22N4O4Si |
| Molecular Weight | 362.46 g/mol |
| Exact Mass | 362.14 |
| IUPAC Name | (2R,3S,5R)-2-[4-amino-5-(2-trimethylsilylethynyl)pyrrolo[2,3-d]pyrimidin-7-yl]-5-(hydroxymethyl)oxolane-3,4-diol |
| SMILES | C[Si](C)(C)C#Cc1cn([C@@H]2O[C@H](CO)C(O)[C@@H]2O)c2ncnc(N)c12 |
| InChI | InChI=1S/C16H22N4O4Si/c1-25(2,3)5-4-9-6-20(15-11(9)14(17)18-8-19-15)16-13(23)12(22)10(7-21)24-16/h6,8,10,12-13,16,21-23H,7H2,1-3H3,(H2,17,18,19)/t10-,12?,13+,16-/m1/s1 |
| InChIKey | GOLYHIJCYFGVNO-ZIWBQIBKSA-N |
| XLogP | -0.15 |
| TPSA | 126.65 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.46 |
| LogP ≤ 5 | -0.15 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|