C19H22N4O2 — CID 59267107
(2R,4R,5R)-2-(4-amino-5-hexa-1,4-diynylpyrrolo[2,3-d]pyrimidin-7-yl)-5-ethyl-4-methyloxolan-3-ol (PubChem CID 59267107) has the molecular formula C19H22N4O2 and a molecular weight of 338.41 g/mol. Its IUPAC name is (2R,4R,5R)-2-(4-amino-5-hexa-1,4-diynylpyrrolo[2,3-d]pyrimidin-7-yl)-5-ethyl-4-methyloxolan-3-ol.
| Compound Name | (2R,4R,5R)-2-(4-amino-5-hexa-1,4-diynylpyrrolo[2,3-d]pyrimidin-7-yl)-5-ethyl-4-methyloxolan-3-ol |
|---|---|
| PubChem CID | 59267107 |
| Molecular Formula | C19H22N4O2 |
| Molecular Weight | 338.41 g/mol |
| Exact Mass | 338.17 |
| IUPAC Name | (2R,4R,5R)-2-(4-amino-5-hexa-1,4-diynylpyrrolo[2,3-d]pyrimidin-7-yl)-5-ethyl-4-methyloxolan-3-ol |
| SMILES | CC#CCC#Cc1cn([C@@H]2O[C@H](CC)[C@H](C)C2O)c2ncnc(N)c12 |
| InChI | InChI=1S/C19H22N4O2/c1-4-6-7-8-9-13-10-23(18-15(13)17(20)21-11-22-18)19-16(24)12(3)14(5-2)25-19/h10-12,14,16,19,24H,5,7H2,1-3H3,(H2,20,21,22)/t12-,14+,16?,19+/m0/s1 |
| InChIKey | NYEXWCHLNQCNFN-LOLRXOILSA-N |
| XLogP | 2.08 |
| TPSA | 86.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|