C17H22N4O2 — CID 155086997
5-but-1-ynyl-7-(5-ethyl-4-methoxyoxolan-2-yl)pyrrolo[2,3-d]pyrimidin-4-amine (PubChem CID 155086997) has the molecular formula C17H22N4O2 and a molecular weight of 314.39 g/mol. Its IUPAC name is 5-but-1-ynyl-7-(5-ethyl-4-methoxyoxolan-2-yl)pyrrolo[2,3-d]pyrimidin-4-amine.
| Compound Name | 5-but-1-ynyl-7-(5-ethyl-4-methoxyoxolan-2-yl)pyrrolo[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 155086997 |
| Molecular Formula | C17H22N4O2 |
| Molecular Weight | 314.39 g/mol |
| Exact Mass | 314.17 |
| IUPAC Name | 5-but-1-ynyl-7-(5-ethyl-4-methoxyoxolan-2-yl)pyrrolo[2,3-d]pyrimidin-4-amine |
| SMILES | CCC#Cc1cn(C2CC(OC)C(CC)O2)c2ncnc(N)c12 |
| InChI | InChI=1S/C17H22N4O2/c1-4-6-7-11-9-21(17-15(11)16(18)19-10-20-17)14-8-13(22-3)12(5-2)23-14/h9-10,12-14H,4-5,8H2,1-3H3,(H2,18,19,20) |
| InChIKey | UGLRLYAAFOCUNP-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.39 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|