C15H19IN4O3S — CID 144630055
2-[4-amino-7-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]ethynyl thiohypoiodite;ethane (PubChem CID 144630055) has the molecular formula C15H19IN4O3S and a molecular weight of 462.31 g/mol. Its IUPAC name is 2-[4-amino-7-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]ethynyl thiohypoiodite;ethane.
| Compound Name | 2-[4-amino-7-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]ethynyl thiohypoiodite;ethane |
|---|---|
| PubChem CID | 144630055 |
| Molecular Formula | C15H19IN4O3S |
| Molecular Weight | 462.31 g/mol |
| Exact Mass | 462.02 |
| IUPAC Name | 2-[4-amino-7-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]pyrrolo[2,3-d]pyrimidin-5-yl]ethynyl thiohypoiodite;ethane |
| SMILES | CC.Nc1ncnc2c1c(C#CSI)cn2C1CC(O)C(CO)O1 |
| InChI | InChI=1S/C13H13IN4O3S.C2H6/c14-22-2-1-7-4-18(10-3-8(20)9(5-19)21-10)13-11(7)12(15)16-6-17-13;1-2/h4,6,8-10,19-20H,3,5H2,(H2,15,16,17);1-2H3 |
| InChIKey | PEKYDWRIORZQIU-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 106.42 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.31 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|