C13H17IN2O5S — CID 144630074
ethane;2-[1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]ethynyl thiohypoiodite (PubChem CID 144630074) has the molecular formula C13H17IN2O5S and a molecular weight of 440.26 g/mol. Its IUPAC name is ethane;2-[1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]ethynyl thiohypoiodite.
| Compound Name | ethane;2-[1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]ethynyl thiohypoiodite |
|---|---|
| PubChem CID | 144630074 |
| Molecular Formula | C13H17IN2O5S |
| Molecular Weight | 440.26 g/mol |
| Exact Mass | 439.99 |
| IUPAC Name | ethane;2-[1-[4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]ethynyl thiohypoiodite |
| SMILES | CC.O=c1[nH]c(=O)n(C2CC(O)C(CO)O2)cc1C#CSI |
| InChI | InChI=1S/C11H11IN2O5S.C2H6/c12-20-2-1-6-4-14(11(18)13-10(6)17)9-3-7(16)8(5-15)19-9;1-2/h4,7-9,15-16H,3,5H2,(H,13,17,18);1-2H3 |
| InChIKey | VLCZEIDHZVAGNS-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.26 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|