C14H27N2O17P3 — CID 173312179
1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-pent-1-ynylpyrimidine-2,4-dione;phosphoric acid (PubChem CID 173312179) has the molecular formula C14H27N2O17P3 and a molecular weight of 588.29 g/mol. Its IUPAC name is 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-pent-1-ynylpyrimidine-2,4-dione;phosphoric acid.
| Compound Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-pent-1-ynylpyrimidine-2,4-dione;phosphoric acid |
|---|---|
| PubChem CID | 173312179 |
| Molecular Formula | C14H27N2O17P3 |
| Molecular Weight | 588.29 g/mol |
| Exact Mass | 588.05 |
| IUPAC Name | 1-[(2R,4S,5R)-4-hydroxy-5-(hydroxymethyl)oxolan-2-yl]-5-pent-1-ynylpyrimidine-2,4-dione;phosphoric acid |
| SMILES | CCCC#Cc1cn([C@H]2C[C@H](O)[C@@H](CO)O2)c(=O)[nH]c1=O.O=P(O)(O)O.O=P(O)(O)O.O=P(O)(O)O |
| InChI | InChI=1S/C14H18N2O5.3H3O4P/c1-2-3-4-5-9-7-16(14(20)15-13(9)19)12-6-10(18)11(8-17)21-12;3*1-5(2,3)4/h7,10-12,17-18H,2-3,6,8H2,1H3,(H,15,19,20);3*(H3,1,2,3,4)/t10-,11+,12+;;;/m0.../s1 |
| InChIKey | VMPONERLPGLYJI-IRVHAZMRSA-N |
| XLogP | -3.46 |
| TPSA | 337.83 Ų |
| H-Bond Donors | 12 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.29 |
| LogP ≤ 5 | -3.46 |
| H-Bond Donors ≤ 5 | 12 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|