C18H22N2O4 — CID 121356688
1-[(2R,4R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-5-octa-1,7-diynylpyrimidine-2,4-dione (PubChem CID 121356688) has the molecular formula C18H22N2O4 and a molecular weight of 330.38 g/mol. Its IUPAC name is 1-[(2R,4R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-5-octa-1,7-diynylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,4R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-5-octa-1,7-diynylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 121356688 |
| Molecular Formula | C18H22N2O4 |
| Molecular Weight | 330.38 g/mol |
| Exact Mass | 330.16 |
| IUPAC Name | 1-[(2R,4R,5R)-5-ethyl-4-hydroxyoxolan-2-yl]-5-octa-1,7-diynylpyrimidine-2,4-dione |
| SMILES | C#CCCCCC#Cc1cn([C@H]2C[C@@H](O)[C@@H](CC)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C18H22N2O4/c1-3-5-6-7-8-9-10-13-12-20(18(23)19-17(13)22)16-11-14(21)15(4-2)24-16/h1,12,14-16,21H,4-8,11H2,2H3,(H,19,22,23)/t14-,15-,16-/m1/s1 |
| InChIKey | DGSAGIHHQRSAAN-BZUAXINKSA-N |
| XLogP | 1.14 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.38 |
| LogP ≤ 5 | 1.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|