C15H20N2O5 — CID 70953350
5-(6-hydroxyhex-1-ynyl)-1-[(2R,4R,5R)-4-hydroxy-5-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 70953350) has the molecular formula C15H20N2O5 and a molecular weight of 308.33 g/mol. Its IUPAC name is 5-(6-hydroxyhex-1-ynyl)-1-[(2R,4R,5R)-4-hydroxy-5-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-(6-hydroxyhex-1-ynyl)-1-[(2R,4R,5R)-4-hydroxy-5-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70953350 |
| Molecular Formula | C15H20N2O5 |
| Molecular Weight | 308.33 g/mol |
| Exact Mass | 308.14 |
| IUPAC Name | 5-(6-hydroxyhex-1-ynyl)-1-[(2R,4R,5R)-4-hydroxy-5-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C[C@H]1O[C@@H](n2cc(C#CCCCCO)c(=O)[nH]c2=O)C[C@H]1O |
| InChI | InChI=1S/C15H20N2O5/c1-10-12(19)8-13(22-10)17-9-11(14(20)16-15(17)21)6-4-2-3-5-7-18/h9-10,12-13,18-19H,2-3,5,7-8H2,1H3,(H,16,20,21)/t10-,12-,13-/m1/s1 |
| InChIKey | YMPCHSYXCPVQMX-RAIGVLPGSA-N |
| XLogP | -0.28 |
| TPSA | 104.55 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.33 |
| LogP ≤ 5 | -0.28 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|