C15H20N2O4 — CID 70953114
5-(6-hydroxyhex-1-ynyl)-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 70953114) has the molecular formula C15H20N2O4 and a molecular weight of 292.34 g/mol. Its IUPAC name is 5-(6-hydroxyhex-1-ynyl)-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-(6-hydroxyhex-1-ynyl)-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 70953114 |
| Molecular Formula | C15H20N2O4 |
| Molecular Weight | 292.34 g/mol |
| Exact Mass | 292.14 |
| IUPAC Name | 5-(6-hydroxyhex-1-ynyl)-1-[(2R,5R)-5-methyloxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | C[C@@H]1CC[C@H](n2cc(C#CCCCCO)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C15H20N2O4/c1-11-7-8-13(21-11)17-10-12(14(19)16-15(17)20)6-4-2-3-5-9-18/h10-11,13,18H,2-3,5,7-9H2,1H3,(H,16,19,20)/t11-,13-/m1/s1 |
| InChIKey | MXTOZNRQIANSAP-DGCLKSJQSA-N |
| XLogP | 0.75 |
| TPSA | 84.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.34 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|