C13H15N3O6 — CID 143047754
N-[3-[1-[5-(hydroperoxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]formamide (PubChem CID 143047754) has the molecular formula C13H15N3O6 and a molecular weight of 309.28 g/mol. Its IUPAC name is N-[3-[1-[5-(hydroperoxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]formamide.
| Compound Name | N-[3-[1-[5-(hydroperoxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]formamide |
|---|---|
| PubChem CID | 143047754 |
| Molecular Formula | C13H15N3O6 |
| Molecular Weight | 309.28 g/mol |
| Exact Mass | 309.10 |
| IUPAC Name | N-[3-[1-[5-(hydroperoxymethyl)oxolan-2-yl]-2,4-dioxopyrimidin-5-yl]prop-2-ynyl]formamide |
| SMILES | O=CNCC#Cc1cn(C2CCC(COO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C13H15N3O6/c17-8-14-5-1-2-9-6-16(13(19)15-12(9)18)11-4-3-10(22-11)7-21-20/h6,8,10-11,20H,3-5,7H2,(H,14,17)(H,15,18,19) |
| InChIKey | VBXHFBJYALTMLA-UHFFFAOYSA-N |
| XLogP | -1.20 |
| TPSA | 122.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.28 |
| LogP ≤ 5 | -1.20 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|