C10H15N2O5P — CID 166965850
[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxyphosphinous acid (PubChem CID 166965850) has the molecular formula C10H15N2O5P and a molecular weight of 274.21 g/mol. Its IUPAC name is [(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxyphosphinous acid.
| Compound Name | [(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxyphosphinous acid |
|---|---|
| PubChem CID | 166965850 |
| Molecular Formula | C10H15N2O5P |
| Molecular Weight | 274.21 g/mol |
| Exact Mass | 274.07 |
| IUPAC Name | [(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxyphosphinous acid |
| SMILES | Cc1cn([C@H]2CC[C@@H](COPO)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N2O5P/c1-6-4-12(10(14)11-9(6)13)8-3-2-7(17-8)5-16-18-15/h4,7-8,15,18H,2-3,5H2,1H3,(H,11,13,14)/t7-,8+/m0/s1 |
| InChIKey | BZNZAGJZMYLNEJ-JGVFFNPUSA-N |
| XLogP | 0.04 |
| TPSA | 93.55 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 274.21 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|