C16H18N2O4S — CID 142887795
5-methyl-1-[(2R,5S)-5-(phenylsulfanyloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione (PubChem CID 142887795) has the molecular formula C16H18N2O4S and a molecular weight of 334.40 g/mol. Its IUPAC name is 5-methyl-1-[(2R,5S)-5-(phenylsulfanyloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione.
| Compound Name | 5-methyl-1-[(2R,5S)-5-(phenylsulfanyloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
|---|---|
| PubChem CID | 142887795 |
| Molecular Formula | C16H18N2O4S |
| Molecular Weight | 334.40 g/mol |
| Exact Mass | 334.10 |
| IUPAC Name | 5-methyl-1-[(2R,5S)-5-(phenylsulfanyloxymethyl)oxolan-2-yl]pyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2CC[C@@H](COSc3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C16H18N2O4S/c1-11-9-18(16(20)17-15(11)19)14-8-7-12(22-14)10-21-23-13-5-3-2-4-6-13/h2-6,9,12,14H,7-8,10H2,1H3,(H,17,19,20)/t12-,14+/m0/s1 |
| InChIKey | YRMQDIWHZULZPH-GXTWGEPZSA-N |
| XLogP | 2.25 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.40 |
| LogP ≤ 5 | 2.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'sulfur_oxygen_single_bond', 'substructure': 'N/A'} |
|---|