C11H17N2O6P — CID 53436996
methyl-[[5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphinic acid (PubChem CID 53436996) has the molecular formula C11H17N2O6P and a molecular weight of 304.24 g/mol. Its IUPAC name is methyl-[[5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphinic acid.
| Compound Name | methyl-[[5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphinic acid |
|---|---|
| PubChem CID | 53436996 |
| Molecular Formula | C11H17N2O6P |
| Molecular Weight | 304.24 g/mol |
| Exact Mass | 304.08 |
| IUPAC Name | methyl-[[5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphinic acid |
| SMILES | Cc1cn(C2CCC(COP(C)(=O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H17N2O6P/c1-7-5-13(11(15)12-10(7)14)9-4-3-8(19-9)6-18-20(2,16)17/h5,8-9H,3-4,6H2,1-2H3,(H,16,17)(H,12,14,15) |
| InChIKey | VAVROBHVXRDAJQ-UHFFFAOYSA-N |
| XLogP | 0.35 |
| TPSA | 110.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.24 |
| LogP ≤ 5 | 0.35 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|