C27H33N4O10P — CID 10371444
1-[(2R,5S)-5-[[[hydroxy(phenyl)methyl]-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 10371444) has the molecular formula C27H33N4O10P and a molecular weight of 604.55 g/mol. Its IUPAC name is 1-[(2R,5S)-5-[[[hydroxy(phenyl)methyl]-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2R,5S)-5-[[[hydroxy(phenyl)methyl]-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 10371444 |
| Molecular Formula | C27H33N4O10P |
| Molecular Weight | 604.55 g/mol |
| Exact Mass | 604.19 |
| IUPAC Name | 1-[(2R,5S)-5-[[[hydroxy(phenyl)methyl]-[[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxymethyl]oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@H]2CC[C@@H](COP(=O)(OC[C@@H]3CC[C@H](n4cc(C)c(=O)[nH]c4=O)O3)C(O)c3ccccc3)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C27H33N4O10P/c1-16-12-30(26(35)28-23(16)32)21-10-8-19(40-21)14-38-42(37,25(34)18-6-4-3-5-7-18)39-15-20-9-11-22(41-20)31-13-17(2)24(33)29-27(31)36/h3-7,12-13,19-22,25,34H,8-11,14-15H2,1-2H3,(H,28,32,35)(H,29,33,36)/t19-,20-,21+,22+,25?/m0/s1 |
| InChIKey | WWEKXVJKGVVCCR-JMVBNQIFSA-N |
| XLogP | 1.98 |
| TPSA | 183.94 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 604.55 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|