C14H23N2O7P — CID 172568202
butyl [(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate (PubChem CID 172568202) has the molecular formula C14H23N2O7P and a molecular weight of 362.32 g/mol. Its IUPAC name is butyl [(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate.
| Compound Name | butyl [(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate |
|---|---|
| PubChem CID | 172568202 |
| Molecular Formula | C14H23N2O7P |
| Molecular Weight | 362.32 g/mol |
| Exact Mass | 362.12 |
| IUPAC Name | butyl [(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hydrogen phosphate |
| SMILES | CCCCOP(=O)(O)OC[C@@H]1CC[C@H](n2cc(C)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C14H23N2O7P/c1-3-4-7-21-24(19,20)22-9-11-5-6-12(23-11)16-8-10(2)13(17)15-14(16)18/h8,11-12H,3-7,9H2,1-2H3,(H,19,20)(H,15,17,18)/t11-,12+/m0/s1 |
| InChIKey | SBGWSELCZMZBLN-NWDGAFQWSA-N |
| XLogP | 1.46 |
| TPSA | 119.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.32 |
| LogP ≤ 5 | 1.46 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|