C10H13IN2O4 — CID 170193041
[(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hypoiodite (PubChem CID 170193041) has the molecular formula C10H13IN2O4 and a molecular weight of 352.13 g/mol. Its IUPAC name is [(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hypoiodite.
| Compound Name | [(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hypoiodite |
|---|---|
| PubChem CID | 170193041 |
| Molecular Formula | C10H13IN2O4 |
| Molecular Weight | 352.13 g/mol |
| Exact Mass | 351.99 |
| IUPAC Name | [(2S,5R)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hypoiodite |
| SMILES | Cc1cn([C@H]2CC[C@@H](COI)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H13IN2O4/c1-6-4-13(10(15)12-9(6)14)8-3-2-7(17-8)5-16-11/h4,7-8H,2-3,5H2,1H3,(H,12,14,15)/t7-,8+/m0/s1 |
| InChIKey | HNRXQGUDMGTICS-JGVFFNPUSA-N |
| XLogP | 0.89 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.13 |
| LogP ≤ 5 | 0.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|