C10H14N2O4 — CID 71028658
1-[(5S)-5-methoxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 71028658) has the molecular formula C10H14N2O4 and a molecular weight of 226.23 g/mol. Its IUPAC name is 1-[(5S)-5-methoxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(5S)-5-methoxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 71028658 |
| Molecular Formula | C10H14N2O4 |
| Molecular Weight | 226.23 g/mol |
| Exact Mass | 226.10 |
| IUPAC Name | 1-[(5S)-5-methoxyoxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | CO[C@@H]1CCC(n2cc(C)c(=O)[nH]c2=O)O1 |
| InChI | InChI=1S/C10H14N2O4/c1-6-5-12(10(14)11-9(6)13)7-3-4-8(15-2)16-7/h5,7-8H,3-4H2,1-2H3,(H,11,13,14)/t7?,8-/m0/s1 |
| InChIKey | BOGWEPJBZZQGBF-MQWKRIRWSA-N |
| XLogP | 0.13 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 226.23 |
| LogP ≤ 5 | 0.13 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |