C11H17N2O4STl — CID 142985854
methanethiol;[5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxythallium (PubChem CID 142985854) has the molecular formula C11H17N2O4STl and a molecular weight of 477.72 g/mol. Its IUPAC name is methanethiol;[5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxythallium.
| Compound Name | methanethiol;[5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxythallium |
|---|---|
| PubChem CID | 142985854 |
| Molecular Formula | C11H17N2O4STl |
| Molecular Weight | 477.72 g/mol |
| Exact Mass | 478.07 |
| IUPAC Name | methanethiol;[5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxythallium |
| SMILES | CS.Cc1cn(C2CCC(CO[Tl])O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H13N2O4.CH4S.Tl/c1-6-4-12(10(15)11-9(6)14)8-3-2-7(5-13)16-8;1-2;/h4,7-8H,2-3,5H2,1H3,(H,11,14,15);2H,1H3;/q-1;;+1 |
| InChIKey | CHYOOIUBJHGGLB-UHFFFAOYSA-N |
| XLogP | 0.17 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 477.72 |
| LogP ≤ 5 | 0.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|