C12H19IN2O4 — CID 142985863
ethane;[(2R,5S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hypoiodite (PubChem CID 142985863) has the molecular formula C12H19IN2O4 and a molecular weight of 382.20 g/mol. Its IUPAC name is ethane;[(2R,5S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hypoiodite.
| Compound Name | ethane;[(2R,5S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hypoiodite |
|---|---|
| PubChem CID | 142985863 |
| Molecular Formula | C12H19IN2O4 |
| Molecular Weight | 382.20 g/mol |
| Exact Mass | 382.04 |
| IUPAC Name | ethane;[(2R,5S)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl hypoiodite |
| SMILES | CC.Cc1cn([C@@H]2CC[C@H](COI)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H13IN2O4.C2H6/c1-6-4-13(10(15)12-9(6)14)8-3-2-7(17-8)5-16-11;1-2/h4,7-8H,2-3,5H2,1H3,(H,12,14,15);1-2H3/t7-,8+;/m1./s1 |
| InChIKey | XQZRDLHEUVHWST-WLYNEOFISA-N |
| XLogP | 1.92 |
| TPSA | 73.32 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.20 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|