C10H13N2O7P-2 — CID 4319719
[5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate (PubChem CID 4319719) has the molecular formula C10H13N2O7P-2 and a molecular weight of 304.20 g/mol. Its IUPAC name is [5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate.
| Compound Name | [5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 4319719 |
| Molecular Formula | C10H13N2O7P-2 |
| Molecular Weight | 304.20 g/mol |
| Exact Mass | 304.05 |
| IUPAC Name | [5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate |
| SMILES | Cc1cn(C2CCC(COP(=O)([O-])[O-])O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H15N2O7P/c1-6-4-12(10(14)11-9(6)13)8-3-2-7(19-8)5-18-20(15,16)17/h4,7-8H,2-3,5H2,1H3,(H,11,13,14)(H2,15,16,17)/p-2 |
| InChIKey | WVNRRNJFRREKAR-UHFFFAOYSA-L |
| XLogP | -1.63 |
| TPSA | 136.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.20 |
| LogP ≤ 5 | -1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|