C10H14N3O7P-2 — CID 15956514
[(2S,3S,5R)-3-amino-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate (PubChem CID 15956514) has the molecular formula C10H14N3O7P-2 and a molecular weight of 319.21 g/mol. Its IUPAC name is [(2S,3S,5R)-3-amino-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate.
| Compound Name | [(2S,3S,5R)-3-amino-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 15956514 |
| Molecular Formula | C10H14N3O7P-2 |
| Molecular Weight | 319.21 g/mol |
| Exact Mass | 319.06 |
| IUPAC Name | [(2S,3S,5R)-3-amino-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate |
| SMILES | Cc1cn([C@H]2C[C@H](N)[C@@H](COP(=O)([O-])[O-])O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H16N3O7P/c1-5-3-13(10(15)12-9(5)14)8-2-6(11)7(20-8)4-19-21(16,17)18/h3,6-8H,2,4,11H2,1H3,(H,12,14,15)(H2,16,17,18)/p-2/t6-,7+,8+/m0/s1 |
| InChIKey | BQZMHQZNZNBJNF-XLPZGREQSA-L |
| XLogP | -2.69 |
| TPSA | 162.53 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.21 |
| LogP ≤ 5 | -2.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|