C11H15N2O8P-2 — CID 510136
[(2S,3R,5R)-3-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate (PubChem CID 510136) has the molecular formula C11H15N2O8P-2 and a molecular weight of 334.22 g/mol. Its IUPAC name is [(2S,3R,5R)-3-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate.
| Compound Name | [(2S,3R,5R)-3-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate |
|---|---|
| PubChem CID | 510136 |
| Molecular Formula | C11H15N2O8P-2 |
| Molecular Weight | 334.22 g/mol |
| Exact Mass | 334.06 |
| IUPAC Name | [(2S,3R,5R)-3-(hydroxymethyl)-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methyl phosphate |
| SMILES | Cc1cn([C@H]2C[C@H](CO)[C@@H](COP(=O)([O-])[O-])O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H17N2O8P/c1-6-3-13(11(16)12-10(6)15)9-2-7(4-14)8(21-9)5-20-22(17,18)19/h3,7-9,14H,2,4-5H2,1H3,(H,12,15,16)(H2,17,18,19)/p-2/t7-,8-,9-/m1/s1 |
| InChIKey | PJHBWHSSFZJDCP-IWSPIJDZSA-L |
| XLogP | -2.41 |
| TPSA | 156.74 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.22 |
| LogP ≤ 5 | -2.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|