C11H17F2N3O11P3S- — CID 15955861
[[[[(2S,3S,5R)-3-amino-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxidophosphinothioyl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid (PubChem CID 15955861) has the molecular formula C11H17F2N3O11P3S- and a molecular weight of 530.25 g/mol. Its IUPAC name is [[[[(2S,3S,5R)-3-amino-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxidophosphinothioyl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid.
| Compound Name | [[[[(2S,3S,5R)-3-amino-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxidophosphinothioyl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 15955861 |
| Molecular Formula | C11H17F2N3O11P3S- |
| Molecular Weight | 530.25 g/mol |
| Exact Mass | 529.98 |
| IUPAC Name | [[[[(2S,3S,5R)-3-amino-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-oxidophosphinothioyl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid |
| SMILES | Cc1cn([C@H]2C[C@H](N)[C@@H](COP([O-])(=S)OP(=O)(O)C(F)(F)P(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H18F2N3O11P3S/c1-5-3-16(10(18)15-9(5)17)8-2-6(14)7(26-8)4-25-30(24,31)27-29(22,23)11(12,13)28(19,20)21/h3,6-8H,2,4,14H2,1H3,(H,22,23)(H,24,31)(H,15,17,18)(H2,19,20,21)/p-1/t6-,7+,8+,30?/m0/s1 |
| InChIKey | JFNSTHZTRJBYRK-YQYWLEPDSA-M |
| XLogP | -1.01 |
| TPSA | 226.46 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 11 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 530.25 |
| LogP ≤ 5 | -1.01 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 11 |
| Structural Alerts | {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|