C11H15F2N5O11P3Se- — CID 15955850
[[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-selenidophosphoryl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid (PubChem CID 15955850) has the molecular formula C11H15F2N5O11P3Se- and a molecular weight of 603.14 g/mol. Its IUPAC name is [[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-selenidophosphoryl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid.
| Compound Name | [[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-selenidophosphoryl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 15955850 |
| Molecular Formula | C11H15F2N5O11P3Se- |
| Molecular Weight | 603.14 g/mol |
| Exact Mass | 603.91 |
| IUPAC Name | [[[[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-selenidophosphoryl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid |
| SMILES | Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](CO[P@@](=O)([Se-])OP(=O)(O)C(F)(F)P(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H16F2N5O11P3Se/c1-5-3-18(10(20)15-9(5)19)8-2-6(16-17-14)7(28-8)4-27-32(26,33)29-31(24,25)11(12,13)30(21,22)23/h3,6-8H,2,4H2,1H3,(H,24,25)(H,26,33)(H,15,19,20)(H2,21,22,23)/p-1/t6-,7+,8+,32+/m0/s1 |
| InChIKey | VLQKQSWENYQDCI-VSBTZKFBSA-M |
| XLogP | 1.03 |
| TPSA | 243.21 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 603.14 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|