C11H17N5O11P2 — CID 59854292
[[[(2S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]-dihydroxymethyl]phosphonic acid (PubChem CID 59854292) has the molecular formula C11H17N5O11P2 and a molecular weight of 457.23 g/mol. Its IUPAC name is [[[(2S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]-dihydroxymethyl]phosphonic acid.
| Compound Name | [[[(2S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]-dihydroxymethyl]phosphonic acid |
|---|---|
| PubChem CID | 59854292 |
| Molecular Formula | C11H17N5O11P2 |
| Molecular Weight | 457.23 g/mol |
| Exact Mass | 457.04 |
| IUPAC Name | [[[(2S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-hydroxyphosphoryl]-dihydroxymethyl]phosphonic acid |
| SMILES | Cc1cn([C@H]2CC(N=[N+]=[N-])[C@@H](COP(=O)(O)C(O)(O)P(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H17N5O11P2/c1-5-3-16(10(18)13-9(5)17)8-2-6(14-15-12)7(27-8)4-26-29(24,25)11(19,20)28(21,22)23/h3,6-8,19-20H,2,4H2,1H3,(H,24,25)(H,13,17,18)(H2,21,22,23)/t6?,7-,8-/m1/s1 |
| InChIKey | SUGYTLOREVYCKV-SPDVFEMOSA-N |
| XLogP | -1.21 |
| TPSA | 257.37 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 457.23 |
| LogP ≤ 5 | -1.21 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|