C11H15F2N8O11P3 — CID 89318515
[[[azido-[[(2S,3R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid (PubChem CID 89318515) has the molecular formula C11H15F2N8O11P3 and a molecular weight of 566.20 g/mol. Its IUPAC name is [[[azido-[[(2S,3R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid.
| Compound Name | [[[azido-[[(2S,3R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid |
|---|---|
| PubChem CID | 89318515 |
| Molecular Formula | C11H15F2N8O11P3 |
| Molecular Weight | 566.20 g/mol |
| Exact Mass | 566.00 |
| IUPAC Name | [[[azido-[[(2S,3R,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy]phosphoryl]oxy-hydroxyphosphoryl]-difluoromethyl]phosphonic acid |
| SMILES | Cc1cn([C@H]2C[C@@H](N=[N+]=[N-])[C@@H](COP(=O)(N=[N+]=[N-])OP(=O)(O)C(F)(F)P(=O)(O)O)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15F2N8O11P3/c1-5-3-21(10(23)16-9(5)22)8-2-6(17-18-14)7(31-8)4-30-35(29,20-19-15)32-34(27,28)11(12,13)33(24,25)26/h3,6-8H,2,4H2,1H3,(H,27,28)(H,16,22,23)(H2,24,25,26)/t6-,7-,8-,35?/m1/s1 |
| InChIKey | YCZHLTZSDPIYKD-LKVFZHAJSA-N |
| XLogP | 2.18 |
| TPSA | 291.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.20 |
| LogP ≤ 5 | 2.18 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|