C10H14N5O6PS — CID 150468637
1-[(2S,4S,5S)-4-azido-5-(dihydroxyphosphinothioyloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione (PubChem CID 150468637) has the molecular formula C10H14N5O6PS and a molecular weight of 363.29 g/mol. Its IUPAC name is 1-[(2S,4S,5S)-4-azido-5-(dihydroxyphosphinothioyloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione.
| Compound Name | 1-[(2S,4S,5S)-4-azido-5-(dihydroxyphosphinothioyloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
|---|---|
| PubChem CID | 150468637 |
| Molecular Formula | C10H14N5O6PS |
| Molecular Weight | 363.29 g/mol |
| Exact Mass | 363.04 |
| IUPAC Name | 1-[(2S,4S,5S)-4-azido-5-(dihydroxyphosphinothioyloxymethyl)oxolan-2-yl]-5-methylpyrimidine-2,4-dione |
| SMILES | Cc1cn([C@@H]2C[C@H](N=[N+]=[N-])[C@@H](COP(O)(O)=S)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C10H14N5O6PS/c1-5-3-15(10(17)12-9(5)16)8-2-6(13-14-11)7(21-8)4-20-22(18,19)23/h3,6-8H,2,4H2,1H3,(H,12,16,17)(H2,18,19,23)/t6-,7+,8-/m0/s1 |
| InChIKey | HRICPELIDAPLLS-RNJXMRFFSA-N |
| XLogP | 0.04 |
| TPSA | 162.54 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.29 |
| LogP ≤ 5 | 0.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|