C17H30ClN6O6P — CID 70683080
[(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(chloromethyl)phosphinic acid;N,N-diethylethanamine (PubChem CID 70683080) has the molecular formula C17H30ClN6O6P and a molecular weight of 480.89 g/mol. Its IUPAC name is [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(chloromethyl)phosphinic acid;N,N-diethylethanamine.
| Compound Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(chloromethyl)phosphinic acid;N,N-diethylethanamine |
|---|---|
| PubChem CID | 70683080 |
| Molecular Formula | C17H30ClN6O6P |
| Molecular Weight | 480.89 g/mol |
| Exact Mass | 480.17 |
| IUPAC Name | [(2S,3S,5R)-3-azido-5-(5-methyl-2,4-dioxopyrimidin-1-yl)oxolan-2-yl]methoxy-(chloromethyl)phosphinic acid;N,N-diethylethanamine |
| SMILES | CCN(CC)CC.Cc1cn([C@H]2C[C@H](N=[N+]=[N-])[C@@H](COP(=O)(O)CCl)O2)c(=O)[nH]c1=O |
| InChI | InChI=1S/C11H15ClN5O6P.C6H15N/c1-6-3-17(11(19)14-10(6)18)9-2-7(15-16-13)8(23-9)4-22-24(20,21)5-12;1-4-7(5-2)6-3/h3,7-9H,2,4-5H2,1H3,(H,20,21)(H,14,18,19);4-6H2,1-3H3/t7-,8+,9+;/m0./s1 |
| InChIKey | RIKRYIVBPLUVCF-FZRXOQNUSA-N |
| XLogP | 2.56 |
| TPSA | 162.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.89 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|